C15H22O3 — CID 14433052
[(1R,5S,6S,12R,15S)-5-methyl-11,13-dioxatetracyclo[7.5.1.01,6.012,15]pentadec-8-en-5-yl]methanol (PubChem CID 14433052) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is [(1R,5S,6S,12R,15S)-5-methyl-11,13-dioxatetracyclo[7.5.1.01,6.012,15]pentadec-8-en-5-yl]methanol.
| Compound Name | [(1R,5S,6S,12R,15S)-5-methyl-11,13-dioxatetracyclo[7.5.1.01,6.012,15]pentadec-8-en-5-yl]methanol |
|---|---|
| PubChem CID | 14433052 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [(1R,5S,6S,12R,15S)-5-methyl-11,13-dioxatetracyclo[7.5.1.01,6.012,15]pentadec-8-en-5-yl]methanol |
| SMILES | C[C@]1(CO)CCC[C@@]23CO[C@H]4OCC(=CC[C@@H]12)[C@H]43 |
| InChI | InChI=1S/C15H22O3/c1-14(8-16)5-2-6-15-9-18-13-12(15)10(7-17-13)3-4-11(14)15/h3,11-13,16H,2,4-9H2,1H3/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | VNQZAZXRYYZGBO-NJVJYBDUSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|