C10H18O3Si — CID 14434984
(4S,5R)-5-hydroxy-4-(2-trimethylsilylethoxy)cyclopent-2-en-1-one (PubChem CID 14434984) has the molecular formula C10H18O3Si and a molecular weight of 214.34 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-4-(2-trimethylsilylethoxy)cyclopent-2-en-1-one.
| Compound Name | (4S,5R)-5-hydroxy-4-(2-trimethylsilylethoxy)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14434984 |
| Molecular Formula | C10H18O3Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (4S,5R)-5-hydroxy-4-(2-trimethylsilylethoxy)cyclopent-2-en-1-one |
| SMILES | C[Si](C)(C)CCO[C@H]1C=CC(=O)[C@@H]1O |
| InChI | InChI=1S/C10H18O3Si/c1-14(2,3)7-6-13-9-5-4-8(11)10(9)12/h4-5,9-10,12H,6-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | FIBPYKPQJARQJL-UWVGGRQHSA-N |
| XLogP | 1.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|