C6H8O3 — CID 14434981
(4S,5R)-5-hydroxy-4-methoxycyclopent-2-en-1-one (PubChem CID 14434981) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-4-methoxycyclopent-2-en-1-one.
| Compound Name | (4S,5R)-5-hydroxy-4-methoxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14434981 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (4S,5R)-5-hydroxy-4-methoxycyclopent-2-en-1-one |
| SMILES | CO[C@H]1C=CC(=O)[C@@H]1O |
| InChI | InChI=1S/C6H8O3/c1-9-5-3-2-4(7)6(5)8/h2-3,5-6,8H,1H3/t5-,6-/m0/s1 |
| InChIKey | IRKONCXNHGPFPK-WDSKDSINSA-N |
| XLogP | -0.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |