C10H16O — CID 14437955
3-methylidene-4a,5,6,7,8,8a-hexahydro-4H-chromene (PubChem CID 14437955) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-methylidene-4a,5,6,7,8,8a-hexahydro-4H-chromene.
| Compound Name | 3-methylidene-4a,5,6,7,8,8a-hexahydro-4H-chromene |
|---|---|
| PubChem CID | 14437955 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 3-methylidene-4a,5,6,7,8,8a-hexahydro-4H-chromene |
| SMILES | C=C1COC2CCCCC2C1 |
| InChI | InChI=1S/C10H16O/c1-8-6-9-4-2-3-5-10(9)11-7-8/h9-10H,1-7H2 |
| InChIKey | VRCUASHSPVJDQE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|