C14H14Cl3N5O4 — CID 14444243
[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[(2,4,6-trichloropyrimido[5,4-d]pyrimidin-8-yl)amino]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 14444243) has the molecular formula C14H14Cl3N5O4 and a molecular weight of 422.66 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[(2,4,6-trichloropyrimido[5,4-d]pyrimidin-8-yl)amino]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[(2,4,6-trichloropyrimido[5,4-d]pyrimidin-8-yl)amino]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 14444243 |
| Molecular Formula | C14H14Cl3N5O4 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[(2,4,6-trichloropyrimido[5,4-d]pyrimidin-8-yl)amino]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2Nc1nc(Cl)nc2c(Cl)nc(Cl)nc12 |
| InChI | InChI=1S/C14H14Cl3N5O4/c1-14(2)25-7-4(3-23)24-11(8(7)26-14)21-10-6-5(18-13(17)22-10)9(15)20-12(16)19-6/h4,7-8,11,23H,3H2,1-2H3,(H,18,21,22)/t4-,7-,8-,11-/m1/s1 |
| InChIKey | ATMDHHUBDVMCNX-TZQXKBMNSA-N |
| XLogP | 2.03 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |