C16H22O2 — CID 14446262
2,5-dimethyl-7-(2-methylphenyl)hept-3-yne-2,5-diol (PubChem CID 14446262) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2,5-dimethyl-7-(2-methylphenyl)hept-3-yne-2,5-diol.
| Compound Name | 2,5-dimethyl-7-(2-methylphenyl)hept-3-yne-2,5-diol |
|---|---|
| PubChem CID | 14446262 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2,5-dimethyl-7-(2-methylphenyl)hept-3-yne-2,5-diol |
| SMILES | Cc1ccccc1CCC(C)(O)C#CC(C)(C)O |
| InChI | InChI=1S/C16H22O2/c1-13-7-5-6-8-14(13)9-10-16(4,18)12-11-15(2,3)17/h5-8,17-18H,9-10H2,1-4H3 |
| InChIKey | RTMFRBIOJCIHCU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|