C25H27NO5 — CID 1444651
[(1R)-2-(cyclohexylamino)-1-(4-methoxyphenyl)-2-oxoethyl] 2H-chromene-3-carboxylate (PubChem CID 1444651) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [(1R)-2-(cyclohexylamino)-1-(4-methoxyphenyl)-2-oxoethyl] 2H-chromene-3-carboxylate.
| Compound Name | [(1R)-2-(cyclohexylamino)-1-(4-methoxyphenyl)-2-oxoethyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 1444651 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [(1R)-2-(cyclohexylamino)-1-(4-methoxyphenyl)-2-oxoethyl] 2H-chromene-3-carboxylate |
| SMILES | COc1ccc([C@@H](OC(=O)C2=Cc3ccccc3OC2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-29-21-13-11-17(12-14-21)23(24(27)26-20-8-3-2-4-9-20)31-25(28)19-15-18-7-5-6-10-22(18)30-16-19/h5-7,10-15,20,23H,2-4,8-9,16H2,1H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | BJHBEKJDLNQRFT-HSZRJFAPSA-N |
| XLogP | 4.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |