C24H25NO4 — CID 6487935
[2-(cyclohexylamino)-2-oxo-1-phenylethyl] 2H-chromene-3-carboxylate (PubChem CID 6487935) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxo-1-phenylethyl] 2H-chromene-3-carboxylate.
| Compound Name | [2-(cyclohexylamino)-2-oxo-1-phenylethyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 6487935 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxo-1-phenylethyl] 2H-chromene-3-carboxylate |
| SMILES | O=C(OC(C(=O)NC1CCCCC1)c1ccccc1)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C24H25NO4/c26-23(25-20-12-5-2-6-13-20)22(17-9-3-1-4-10-17)29-24(27)19-15-18-11-7-8-14-21(18)28-16-19/h1,3-4,7-11,14-15,20,22H,2,5-6,12-13,16H2,(H,25,26) |
| InChIKey | CLGHAQSMBUXYIF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |