[(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate

C24H20O4 — CID 3231535

IUPAC[(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate
SMILESCOc1ccc(C(OC(=O)C2=Cc3ccccc3OC2)c2ccccc2)cc1
InChIInChI=1S/C24H20O4/c1-26-21-13-11-18(12-14-21)23(17-7-3-2-4-8-17)28-24(25)20-15-19-9-5-6-10-22(19)27-16-20/h2-15,23H,16H2,1H3
InChIKeySRKHWHSQFMXBMP-UHFFFAOYSA-N
MW372.42 g/mol
LogP4.80
Rot. Bonds5

About [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate

[(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate (PubChem CID 3231535) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate.

Molecular Properties

Compound Name[(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate
PubChem CID3231535
Molecular FormulaC24H20O4
Molecular Weight372.42 g/mol
Exact Mass372.14
IUPAC Name[(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate
SMILESCOc1ccc(C(OC(=O)C2=Cc3ccccc3OC2)c2ccccc2)cc1
InChIInChI=1S/C24H20O4/c1-26-21-13-11-18(12-14-21)23(17-7-3-2-4-8-17)28-24(25)20-15-19-9-5-6-10-22(19)27-16-20/h2-15,23H,16H2,1H3
InChIKeySRKHWHSQFMXBMP-UHFFFAOYSA-N
XLogP4.80
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500372.42
LogP ≤ 54.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate?
The IUPAC name of [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate (CID 3231535) is [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate.
What is the SMILES notation for [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate?
The canonical SMILES for [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate is COc1ccc(C(OC(=O)C2=Cc3ccccc3OC2)c2ccccc2)cc1.
What is the InChIKey of [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate?
The InChIKey is SRKHWHSQFMXBMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O4/c1-26-21-13-11-18(12-14-21)23(17-7-3-2-4-8-17)28-24(25)20-15-19-9-5-6-10-22(19)27-16-20/h2-15,23H,16H2,1H3.
What are the key properties of [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate?
[(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate has a molecular weight of 372.42 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methoxyphenyl)-phenylmethyl] 2H-chromene-3-carboxylate is sourced from PubChem (CID 3231535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).