C10H12O5 — CID 14446592
2-acetyl-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 14446592) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-acetyl-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 2-acetyl-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 14446592 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-acetyl-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | CC(=O)C1=C(O)C(C)=C(O)C(C)(O)C1=O |
| InChI | InChI=1S/C10H12O5/c1-4-7(12)6(5(2)11)9(14)10(3,15)8(4)13/h12-13,15H,1-3H3 |
| InChIKey | NTARYVBECPSAQM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|