C19H19NO8 — CID 14449915
2-O-ethyl 3-O,4-O-dimethyl 1-(2-hydroxy-4-methylphenyl)-6-oxopyridine-2,3,4-tricarboxylate (PubChem CID 14449915) has the molecular formula C19H19NO8 and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl 1-(2-hydroxy-4-methylphenyl)-6-oxopyridine-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl 1-(2-hydroxy-4-methylphenyl)-6-oxopyridine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 14449915 |
| Molecular Formula | C19H19NO8 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl 1-(2-hydroxy-4-methylphenyl)-6-oxopyridine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OC)c(C(=O)OC)cc(=O)n1-c1ccc(C)cc1O |
| InChI | InChI=1S/C19H19NO8/c1-5-28-19(25)16-15(18(24)27-4)11(17(23)26-3)9-14(22)20(16)12-7-6-10(2)8-13(12)21/h6-9,21H,5H2,1-4H3 |
| InChIKey | QKNXFMHQBJBIJS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|