C23H17F2N5S — CID 144500931
N-[[(Z)-2-(2,4-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 144500931) has the molecular formula C23H17F2N5S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[[(Z)-2-(2,4-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[[(Z)-2-(2,4-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 144500931 |
| Molecular Formula | C23H17F2N5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[[(Z)-2-(2,4-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | C=N/C(=C\SCNc1nc(-c2cccnc2)nc2ccccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H17F2N5S/c1-26-21(17-9-8-16(24)11-19(17)25)13-31-14-28-23-18-6-2-3-7-20(18)29-22(30-23)15-5-4-10-27-12-15/h2-13H,1,14H2,(H,28,29,30)/b21-13- |
| InChIKey | GYAIZUWRYRDTBZ-BKUYFWCQSA-N |
| XLogP | 5.77 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|