C24H19F2N5OS — CID 144501327
N-[[(Z)-2-(2,5-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-6-methoxy-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 144501327) has the molecular formula C24H19F2N5OS and a molecular weight of 463.51 g/mol. Its IUPAC name is N-[[(Z)-2-(2,5-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-6-methoxy-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[[(Z)-2-(2,5-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-6-methoxy-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 144501327 |
| Molecular Formula | C24H19F2N5OS |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-[[(Z)-2-(2,5-difluorophenyl)-2-(methylideneamino)ethenyl]sulfanylmethyl]-6-methoxy-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | C=N/C(=C\SCNc1nc(-c2cccnc2)nc2ccc(OC)cc12)c1cc(F)ccc1F |
| InChI | InChI=1S/C24H19F2N5OS/c1-27-22(18-10-16(25)5-7-20(18)26)13-33-14-29-24-19-11-17(32-2)6-8-21(19)30-23(31-24)15-4-3-9-28-12-15/h3-13H,1,14H2,2H3,(H,29,30,31)/b22-13- |
| InChIKey | RGNXKXMKWWOWPY-XKZIYDEJSA-N |
| XLogP | 5.78 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|