C25H22N6O2S — CID 135127958
(Z)-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide (PubChem CID 135127958) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is (Z)-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135127958 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (Z)-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide |
| SMILES | C=N/C(=C(\SCNc1nc(-c2cccnc2)nc2ccc(OC)cc12)C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C25H22N6O2S/c1-27-21(16-7-4-3-5-8-16)22(23(26)32)34-15-29-25-19-13-18(33-2)10-11-20(19)30-24(31-25)17-9-6-12-28-14-17/h3-14H,1,15H2,2H3,(H2,26,32)(H,29,30,31)/b22-21- |
| InChIKey | GPGXTSZRHTURAC-DQRAZIAOSA-N |
| XLogP | 4.36 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|