C27H26N6O2S — CID 135128026
(Z)-N-ethyl-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide (PubChem CID 135128026) has the molecular formula C27H26N6O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is (Z)-N-ethyl-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-ethyl-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135128026 |
| Molecular Formula | C27H26N6O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (Z)-N-ethyl-2-[[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]methylsulfanyl]-3-(methylideneamino)-3-phenylprop-2-enamide |
| SMILES | C=N/C(=C(\SCNc1nc(-c2cccnc2)nc2ccc(OC)cc12)C(=O)NCC)c1ccccc1 |
| InChI | InChI=1S/C27H26N6O2S/c1-4-30-27(34)24(23(28-2)18-9-6-5-7-10-18)36-17-31-26-21-15-20(35-3)12-13-22(21)32-25(33-26)19-11-8-14-29-16-19/h5-16H,2,4,17H2,1,3H3,(H,30,34)(H,31,32,33)/b24-23- |
| InChIKey | WRNAHRLUAUGIKA-VHXPQNKSSA-N |
| XLogP | 5.01 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|