C23H26N2O — CID 144502059
3-[[[(2E,4Z,7E,9E)-7-ethenyl-9-methoxy-6-methylideneundeca-2,4,7,9-tetraen-2-yl]amino]methyl]benzonitrile (PubChem CID 144502059) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-[[[(2E,4Z,7E,9E)-7-ethenyl-9-methoxy-6-methylideneundeca-2,4,7,9-tetraen-2-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[(2E,4Z,7E,9E)-7-ethenyl-9-methoxy-6-methylideneundeca-2,4,7,9-tetraen-2-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 144502059 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-[[[(2E,4Z,7E,9E)-7-ethenyl-9-methoxy-6-methylideneundeca-2,4,7,9-tetraen-2-yl]amino]methyl]benzonitrile |
| SMILES | C=C/C(=C\C(=C/C)OC)C(=C)/C=C\C=C(/C)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C23H26N2O/c1-6-22(15-23(7-2)26-5)18(3)10-8-11-19(4)25-17-21-13-9-12-20(14-21)16-24/h6-15,25H,1,3,17H2,2,4-5H3/b10-8-,19-11+,22-15+,23-7+ |
| InChIKey | VDAIOWXBHZHSCR-XHCSGUHYSA-N |
| XLogP | 5.33 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|