C55H62F2 — CID 144502766
1-fluoro-4-[4-[4-[7-[4-[4-(4-fluoro-2,3-dimethylphenyl)-2,6-dimethylphenyl]-2,6-dimethylphenyl]heptyl]-3,5-dimethylphenyl]-3,5-dimethylphenyl]-2,3-dimethylbenzene (PubChem CID 144502766) has the molecular formula C55H62F2 and a molecular weight of 761.10 g/mol. Its IUPAC name is 1-fluoro-4-[4-[4-[7-[4-[4-(4-fluoro-2,3-dimethylphenyl)-2,6-dimethylphenyl]-2,6-dimethylphenyl]heptyl]-3,5-dimethylphenyl]-3,5-dimethylphenyl]-2,3-dimethylbenzene.
| Compound Name | 1-fluoro-4-[4-[4-[7-[4-[4-(4-fluoro-2,3-dimethylphenyl)-2,6-dimethylphenyl]-2,6-dimethylphenyl]heptyl]-3,5-dimethylphenyl]-3,5-dimethylphenyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 144502766 |
| Molecular Formula | C55H62F2 |
| Molecular Weight | 761.10 g/mol |
| Exact Mass | 760.48 |
| IUPAC Name | 1-fluoro-4-[4-[4-[7-[4-[4-(4-fluoro-2,3-dimethylphenyl)-2,6-dimethylphenyl]-2,6-dimethylphenyl]heptyl]-3,5-dimethylphenyl]-3,5-dimethylphenyl]-2,3-dimethylbenzene |
| SMILES | Cc1cc(-c2c(C)cc(-c3ccc(F)c(C)c3C)cc2C)cc(C)c1CCCCCCCc1c(C)cc(-c2c(C)cc(-c3ccc(F)c(C)c3C)cc2C)cc1C |
| InChI | InChI=1S/C55H62F2/c1-32-24-46(54-36(5)28-44(29-37(54)6)50-20-22-52(56)42(11)40(50)9)25-33(2)48(32)18-16-14-13-15-17-19-49-34(3)26-47(27-35(49)4)55-38(7)30-45(31-39(55)8)51-21-23-53(57)43(12)41(51)10/h20-31H,13-19H2,1-12H3 |
| InChIKey | FUMPRNSGKQBVDN-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.10 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|