C20H21NO2S — CID 144503534
sulfanyl 2-[4-methylidene-2-[(4-methylphenyl)methyl]-1,3-dihydroisoquinolin-1-yl]acetate (PubChem CID 144503534) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is sulfanyl 2-[4-methylidene-2-[(4-methylphenyl)methyl]-1,3-dihydroisoquinolin-1-yl]acetate.
| Compound Name | sulfanyl 2-[4-methylidene-2-[(4-methylphenyl)methyl]-1,3-dihydroisoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 144503534 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | sulfanyl 2-[4-methylidene-2-[(4-methylphenyl)methyl]-1,3-dihydroisoquinolin-1-yl]acetate |
| SMILES | C=C1CN(Cc2ccc(C)cc2)C(CC(=O)OS)c2ccccc21 |
| InChI | InChI=1S/C20H21NO2S/c1-14-7-9-16(10-8-14)13-21-12-15(2)17-5-3-4-6-18(17)19(21)11-20(22)23-24/h3-10,19,24H,2,11-13H2,1H3 |
| InChIKey | ITXHPQXVRXRCBD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|