C9H10ClN — CID 144503751
(3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine (PubChem CID 144503751) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is (3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine.
| Compound Name | (3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine |
|---|---|
| PubChem CID | 144503751 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | (3E,4Z)-2-chloro-3,4-di(ethylidene)pyridine |
| SMILES | C/C=c1/ccnc(Cl)/c1=C/C |
| InChI | InChI=1S/C9H10ClN/c1-3-7-5-6-11-9(10)8(7)4-2/h3-6H,1-2H3/b7-3-,8-4+ |
| InChIKey | XKEJXJCJWVRANV-KYPMKJFLSA-N |
| XLogP | 1.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|