C30H40N2O5 — CID 144504953
N-benzyl-5-(2,6-dimethyl-4-propylphenoxy)-2-hydroxybenzamide;ethane;N-(2-hydroxyethyl)formamide (PubChem CID 144504953) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-benzyl-5-(2,6-dimethyl-4-propylphenoxy)-2-hydroxybenzamide;ethane;N-(2-hydroxyethyl)formamide.
| Compound Name | N-benzyl-5-(2,6-dimethyl-4-propylphenoxy)-2-hydroxybenzamide;ethane;N-(2-hydroxyethyl)formamide |
|---|---|
| PubChem CID | 144504953 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-benzyl-5-(2,6-dimethyl-4-propylphenoxy)-2-hydroxybenzamide;ethane;N-(2-hydroxyethyl)formamide |
| SMILES | CC.CCCc1cc(C)c(Oc2ccc(O)c(C(=O)NCc3ccccc3)c2)c(C)c1.O=CNCCO |
| InChI | InChI=1S/C25H27NO3.C3H7NO2.C2H6/c1-4-8-20-13-17(2)24(18(3)14-20)29-21-11-12-23(27)22(15-21)25(28)26-16-19-9-6-5-7-10-19;5-2-1-4-3-6;1-2/h5-7,9-15,27H,4,8,16H2,1-3H3,(H,26,28);3,5H,1-2H2,(H,4,6);1-2H3 |
| InChIKey | SBDVOGQLLFLFLJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|