C26H28N2O5S — CID 144504692
5-[2,6-dimethyl-4-[3-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]-3-oxopropyl]phenoxy]-2-hydroxy-N-phenylbenzamide (PubChem CID 144504692) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 5-[2,6-dimethyl-4-[3-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]-3-oxopropyl]phenoxy]-2-hydroxy-N-phenylbenzamide.
| Compound Name | 5-[2,6-dimethyl-4-[3-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]-3-oxopropyl]phenoxy]-2-hydroxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 144504692 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 5-[2,6-dimethyl-4-[3-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]-3-oxopropyl]phenoxy]-2-hydroxy-N-phenylbenzamide |
| SMILES | C=S(C)(=O)NC(=O)CCc1cc(C)c(Oc2ccc(O)c(C(=O)Nc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C26H28N2O5S/c1-17-14-19(10-13-24(30)28-34(3,4)32)15-18(2)25(17)33-21-11-12-23(29)22(16-21)26(31)27-20-8-6-5-7-9-20/h5-9,11-12,14-16,29H,3,10,13H2,1-2,4H3,(H,27,31)(H,28,30,32) |
| InChIKey | YLCWJOQDDHGAKA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|