C25H23I2NO5 — CID 159354151
2-hydroxy-5-[4-(6-hydroxy-3-oxohexyl)-2,6-diiodophenoxy]-N-phenylbenzamide (PubChem CID 159354151) has the molecular formula C25H23I2NO5 and a molecular weight of 671.27 g/mol. Its IUPAC name is 2-hydroxy-5-[4-(6-hydroxy-3-oxohexyl)-2,6-diiodophenoxy]-N-phenylbenzamide.
| Compound Name | 2-hydroxy-5-[4-(6-hydroxy-3-oxohexyl)-2,6-diiodophenoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 159354151 |
| Molecular Formula | C25H23I2NO5 |
| Molecular Weight | 671.27 g/mol |
| Exact Mass | 670.97 |
| IUPAC Name | 2-hydroxy-5-[4-(6-hydroxy-3-oxohexyl)-2,6-diiodophenoxy]-N-phenylbenzamide |
| SMILES | O=C(CCCO)CCc1cc(I)c(Oc2ccc(O)c(C(=O)Nc3ccccc3)c2)c(I)c1 |
| InChI | InChI=1S/C25H23I2NO5/c26-21-13-16(8-9-18(30)7-4-12-29)14-22(27)24(21)33-19-10-11-23(31)20(15-19)25(32)28-17-5-2-1-3-6-17/h1-3,5-6,10-11,13-15,29,31H,4,7-9,12H2,(H,28,32) |
| InChIKey | LHSCRWRQOSDPDZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|