C10H17F2N — CID 144507428
cis-(1R,3S)-N-(2,2-difluorobut-3-enyl)-3-methylcyclopentan-1-amine (PubChem CID 144507428) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is cis-(1R,3S)-N-(2,2-difluorobut-3-enyl)-3-methylcyclopentan-1-amine.
| Compound Name | cis-(1R,3S)-N-(2,2-difluorobut-3-enyl)-3-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 144507428 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | cis-(1R,3S)-N-(2,2-difluorobut-3-enyl)-3-methylcyclopentan-1-amine |
| SMILES | C=CC(F)(F)CN[C@@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/C10H17F2N/c1-3-10(11,12)7-13-9-5-4-8(2)6-9/h3,8-9,13H,1,4-7H2,2H3/t8-,9+/m0/s1 |
| InChIKey | IPNKKHOAYKCLRO-DTWKUNHWSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|