C36H57F3N4OS — CID 144510645
ethyl (Z)-N-methyl-2-methyliminopent-3-enimidothioate;(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone;4-methylheptane (PubChem CID 144510645) has the molecular formula C36H57F3N4OS and a molecular weight of 650.94 g/mol. Its IUPAC name is ethyl (Z)-N-methyl-2-methyliminopent-3-enimidothioate;(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone;4-methylheptane.
| Compound Name | ethyl (Z)-N-methyl-2-methyliminopent-3-enimidothioate;(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone;4-methylheptane |
|---|---|
| PubChem CID | 144510645 |
| Molecular Formula | C36H57F3N4OS |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | ethyl (Z)-N-methyl-2-methyliminopent-3-enimidothioate;(2-methyl-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone;4-methylheptane |
| SMILES | C/C=C\C(=N/C)\C(=N\C)SCC.CC1CC2CCCC2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1.CCCC(C)CCC |
| InChI | InChI=1S/C19H23F3N2O.C9H16N2S.C8H18/c1-12-7-14-3-2-5-18(14,9-12)17(25)24-6-4-16-13(11-24)8-15(10-23-16)19(20,21)22;1-5-7-8(10-3)9(11-4)12-6-2;1-4-6-8(3)7-5-2/h8,10,12,14H,2-7,9,11H2,1H3;5,7H,6H2,1-4H3;8H,4-7H2,1-3H3/b;7-5-,10-8+,11-9-; |
| InChIKey | REWPCAAASNZBAN-YSZWCTHTSA-N |
| XLogP | 9.84 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|