C30H35N7O3 — CID 144511294
4-[8-amino-3-[(2S)-1-methylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-3-methyl-N-pyridin-2-ylbenzamide;(E)-4-methoxybut-2-enal (PubChem CID 144511294) has the molecular formula C30H35N7O3 and a molecular weight of 541.66 g/mol. Its IUPAC name is 4-[8-amino-3-[(2S)-1-methylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-3-methyl-N-pyridin-2-ylbenzamide;(E)-4-methoxybut-2-enal.
| Compound Name | 4-[8-amino-3-[(2S)-1-methylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-3-methyl-N-pyridin-2-ylbenzamide;(E)-4-methoxybut-2-enal |
|---|---|
| PubChem CID | 144511294 |
| Molecular Formula | C30H35N7O3 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 4-[8-amino-3-[(2S)-1-methylpiperidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-3-methyl-N-pyridin-2-ylbenzamide;(E)-4-methoxybut-2-enal |
| SMILES | COC/C=C/C=O.Cc1cc(C(=O)Nc2ccccn2)ccc1-c1nc([C@@H]2CCCCN2C)n2ccnc(N)c12 |
| InChI | InChI=1S/C25H27N7O.C5H8O2/c1-16-15-17(25(33)29-20-8-3-5-11-27-20)9-10-18(16)21-22-23(26)28-12-14-32(22)24(30-21)19-7-4-6-13-31(19)2;1-7-5-3-2-4-6/h3,5,8-12,14-15,19H,4,6-7,13H2,1-2H3,(H2,26,28)(H,27,29,33);2-4H,5H2,1H3/b;3-2+/t19-;/m0./s1 |
| InChIKey | POMWOYRJPGPQLE-VNJIBQONSA-N |
| XLogP | 4.48 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|