C29H32N7O3+ — CID 90186229
4-[4-amino-1-[(2S)-1-[(E)-4-methoxybut-2-enoyl]piperidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methyl-N-pyridin-2-ylbenzamide (PubChem CID 90186229) has the molecular formula C29H32N7O3+ and a molecular weight of 526.62 g/mol. Its IUPAC name is 4-[4-amino-1-[(2S)-1-[(E)-4-methoxybut-2-enoyl]piperidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methyl-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-amino-1-[(2S)-1-[(E)-4-methoxybut-2-enoyl]piperidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methyl-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 90186229 |
| Molecular Formula | C29H32N7O3+ |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 4-[4-amino-1-[(2S)-1-[(E)-4-methoxybut-2-enoyl]piperidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methyl-N-pyridin-2-ylbenzamide |
| SMILES | COC/C=C/C(=O)N1CCCC[C@H]1C1=C2C=NC=C[N+]2(N)C(c2ccc(C(=O)Nc3ccccn3)cc2C)=N1 |
| InChI | InChI=1S/C29H31N7O3/c1-20-18-21(29(38)33-25-9-3-5-13-32-25)11-12-22(20)28-34-27(24-19-31-14-16-36(24,28)30)23-8-4-6-15-35(23)26(37)10-7-17-39-2/h3,5,7,9-14,16,18-19,23H,4,6,8,15,17,30H2,1-2H3/p+1/b10-7+/t23-,36?/m0/s1 |
| InChIKey | KRIOIUZMBHEEDI-GCSVJUECSA-O |
| XLogP | 3.44 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|