C24H24N7O3+ — CID 89389004
4-[4-amino-1-[[[(E)-4-methoxybut-2-enoyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide (PubChem CID 89389004) has the molecular formula C24H24N7O3+ and a molecular weight of 458.50 g/mol. Its IUPAC name is 4-[4-amino-1-[[[(E)-4-methoxybut-2-enoyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-amino-1-[[[(E)-4-methoxybut-2-enoyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 89389004 |
| Molecular Formula | C24H24N7O3+ |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-[4-amino-1-[[[(E)-4-methoxybut-2-enoyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
| SMILES | COC/C=C/C(=O)NCC1=C2C=NC=C[N+]2(N)C(c2ccc(C(=O)Nc3ccccn3)cc2)=N1 |
| InChI | InChI=1S/C24H23N7O3/c1-34-14-4-6-22(32)28-15-19-20-16-26-12-13-31(20,25)23(29-19)17-7-9-18(10-8-17)24(33)30-21-5-2-3-11-27-21/h2-13,16H,14-15,25H2,1H3,(H-,27,28,30,32,33)/p+1/b6-4+ |
| InChIKey | KRQFRWKMAOOIKT-GQCTYLIASA-O |
| XLogP | 1.87 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|