C31H37N8O2+ — CID 90186165
4-[4-amino-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propan-2-yl-2-pyridinyl)benzamide (PubChem CID 90186165) has the molecular formula C31H37N8O2+ and a molecular weight of 553.69 g/mol. Its IUPAC name is 4-[4-amino-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propan-2-yl-2-pyridinyl)benzamide.
| Compound Name | 4-[4-amino-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propan-2-yl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 90186165 |
| Molecular Formula | C31H37N8O2+ |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | 4-[4-amino-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propan-2-yl-2-pyridinyl)benzamide |
| SMILES | CC(C)c1ccnc(NC(=O)c2ccc(C3=NC(C4CCCN4C(=O)/C=C/CN(C)C)=C4C=NC=C[N+]34N)cc2)c1 |
| InChI | InChI=1S/C31H36N8O2/c1-21(2)24-13-14-34-27(19-24)35-31(41)23-11-9-22(10-12-23)30-36-29(26-20-33-15-18-39(26,30)32)25-7-5-17-38(25)28(40)8-6-16-37(3)4/h6,8-15,18-21,25H,5,7,16-17,32H2,1-4H3/p+1/b8-6+ |
| InChIKey | LRCVFEQIAYMLGC-SOFGYWHQSA-O |
| XLogP | 3.78 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|