C28H29N6O2+ — CID 89389221
N-(4-ethyl-2-pyridinyl)-4-[4-methyl-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]benzamide (PubChem CID 89389221) has the molecular formula C28H29N6O2+ and a molecular weight of 481.58 g/mol. Its IUPAC name is N-(4-ethyl-2-pyridinyl)-4-[4-methyl-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]benzamide.
| Compound Name | N-(4-ethyl-2-pyridinyl)-4-[4-methyl-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]benzamide |
|---|---|
| PubChem CID | 89389221 |
| Molecular Formula | C28H29N6O2+ |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-(4-ethyl-2-pyridinyl)-4-[4-methyl-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]benzamide |
| SMILES | C=CC(=O)N1CCCC1C1=C2C=NC=C[N+]2(C)C(c2ccc(C(=O)Nc3cc(CC)ccn3)cc2)=N1 |
| InChI | InChI=1S/C28H28N6O2/c1-4-19-12-13-30-24(17-19)31-28(36)21-10-8-20(9-11-21)27-32-26(23-18-29-14-16-34(23,27)3)22-7-6-15-33(22)25(35)5-2/h5,8-14,16-18,22H,2,4,6-7,15H2,1,3H3/p+1 |
| InChIKey | MFPVSFFNNFGYHE-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|