C29H31N6O2+ — CID 89388867
4-[1-[1-[but-2-ynoyl(methyl)amino]ethyl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propyl-2-pyridinyl)benzamide (PubChem CID 89388867) has the molecular formula C29H31N6O2+ and a molecular weight of 495.61 g/mol. Its IUPAC name is 4-[1-[1-[but-2-ynoyl(methyl)amino]ethyl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propyl-2-pyridinyl)benzamide.
| Compound Name | 4-[1-[1-[but-2-ynoyl(methyl)amino]ethyl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 89388867 |
| Molecular Formula | C29H31N6O2+ |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 4-[1-[1-[but-2-ynoyl(methyl)amino]ethyl]-4-methylimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-propyl-2-pyridinyl)benzamide |
| SMILES | CC#CC(=O)N(C)C(C)C1=C2C=NC=C[N+]2(C)C(c2ccc(C(=O)Nc3cc(CCC)ccn3)cc2)=N1 |
| InChI | InChI=1S/C29H30N6O2/c1-6-8-21-14-15-31-25(18-21)32-29(37)23-12-10-22(11-13-23)28-33-27(20(3)34(4)26(36)9-7-2)24-19-30-16-17-35(24,28)5/h10-20H,6,8H2,1-5H3/p+1 |
| InChIKey | BPYBKRHWAUCVNF-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|