C28H28N7O2+ — CID 89389240
2-[4-amino-1-(1-but-2-ynoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-ethyl-2-pyridinyl)benzamide (PubChem CID 89389240) has the molecular formula C28H28N7O2+ and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-[4-amino-1-(1-but-2-ynoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-ethyl-2-pyridinyl)benzamide.
| Compound Name | 2-[4-amino-1-(1-but-2-ynoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-ethyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 89389240 |
| Molecular Formula | C28H28N7O2+ |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[4-amino-1-(1-but-2-ynoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-ethyl-2-pyridinyl)benzamide |
| SMILES | CC#CC(=O)N1CCCC1C1=C2C=NC=C[N+]2(N)C(c2ccccc2C(=O)Nc2cc(CC)ccn2)=N1 |
| InChI | InChI=1S/C28H27N7O2/c1-3-8-25(36)34-15-7-11-22(34)26-23-18-30-14-16-35(23,29)27(33-26)20-9-5-6-10-21(20)28(37)32-24-17-19(4-2)12-13-31-24/h5-6,9-10,12-14,16-18,22H,4,7,11,15,29H2,1-2H3/p+1 |
| InChIKey | KXACAFUZQRXAPY-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|