C26H26N7O3+ — CID 89389676
2-[4-amino-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-4-methoxy-N-pyridin-2-ylbenzamide (PubChem CID 89389676) has the molecular formula C26H26N7O3+ and a molecular weight of 484.54 g/mol. Its IUPAC name is 2-[4-amino-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-4-methoxy-N-pyridin-2-ylbenzamide.
| Compound Name | 2-[4-amino-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-4-methoxy-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 89389676 |
| Molecular Formula | C26H26N7O3+ |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[4-amino-1-(1-prop-2-enoylpyrrolidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-4-methoxy-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1CCCC1C1=C2C=NC=C[N+]2(N)C(c2cc(OC)ccc2C(=O)Nc2ccccn2)=N1 |
| InChI | InChI=1S/C26H25N7O3/c1-3-23(34)32-13-6-7-20(32)24-21-16-28-12-14-33(21,27)25(31-24)19-15-17(36-2)9-10-18(19)26(35)30-22-8-4-5-11-29-22/h3-5,8-12,14-16,20H,1,6-7,13,27H2,2H3/p+1 |
| InChIKey | UFEDZIKOJSZYNG-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|