C27H30N7O3+ — CID 90311762
4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-methoxy-2-pyridinyl)benzamide (PubChem CID 90311762) has the molecular formula C27H30N7O3+ and a molecular weight of 500.58 g/mol. Its IUPAC name is 4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-methoxy-2-pyridinyl)benzamide.
| Compound Name | 4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-methoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 90311762 |
| Molecular Formula | C27H30N7O3+ |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(4-methoxy-2-pyridinyl)benzamide |
| SMILES | CCC(=O)N1CCC[C@@H](C2=C3C=NC=C[N+]3(N)C(c3ccc(C(=O)Nc4cc(OC)ccn4)cc3)=N2)C1 |
| InChI | InChI=1S/C27H29N7O3/c1-3-24(35)33-13-4-5-20(17-33)25-22-16-29-12-14-34(22,28)26(32-25)18-6-8-19(9-7-18)27(36)31-23-15-21(37-2)10-11-30-23/h6-12,14-16,20H,3-5,13,17,28H2,1-2H3/p+1/t20-,34?/m1/s1 |
| InChIKey | RNQHGQYZAKRAAD-DKVUXROGSA-O |
| XLogP | 3.21 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|