C30H32F3N8O2+ — CID 89389424
4-[4-amino-1-[(3R)-1-[(3R)-1-methylpyrrolidine-3-carbonyl]piperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 89389424) has the molecular formula C30H32F3N8O2+ and a molecular weight of 593.63 g/mol. Its IUPAC name is 4-[4-amino-1-[(3R)-1-[(3R)-1-methylpyrrolidine-3-carbonyl]piperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[4-amino-1-[(3R)-1-[(3R)-1-methylpyrrolidine-3-carbonyl]piperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 89389424 |
| Molecular Formula | C30H32F3N8O2+ |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 4-[4-amino-1-[(3R)-1-[(3R)-1-methylpyrrolidine-3-carbonyl]piperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CN1CC[C@@H](C(=O)N2CCC[C@@H](C3=C4C=NC=C[N+]4(N)C(c4ccc(C(=O)Nc5cc(C(F)(F)F)ccn5)cc4)=N3)C2)C1 |
| InChI | InChI=1S/C30H31F3N8O2/c1-39-13-9-22(17-39)29(43)40-12-2-3-21(18-40)26-24-16-35-11-14-41(24,34)27(38-26)19-4-6-20(7-5-19)28(42)37-25-15-23(8-10-36-25)30(31,32)33/h4-8,10-11,14-16,21-22H,2-3,9,12-13,17-18,34H2,1H3/p+1/t21-,22-,41?/m1/s1 |
| InChIKey | AAVFPPSPKXFIIW-IPBGCOLNSA-O |
| XLogP | 3.76 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|