C28H29F3N7O3+ — CID 90311621
4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 90311621) has the molecular formula C28H29F3N7O3+ and a molecular weight of 568.58 g/mol. Its IUPAC name is 4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90311621 |
| Molecular Formula | C28H29F3N7O3+ |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 4-[4-amino-1-[(3R)-1-propanoylpiperidin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CCC(=O)N1CCC[C@@H](C2=C3C=NC=C[N+]3(N)C(c3ccc(C(=O)Nc4cc(C(F)(F)F)ccn4)cc3OC)=N2)C1 |
| InChI | InChI=1S/C28H28F3N7O3/c1-3-24(39)37-11-4-5-18(16-37)25-21-15-33-10-12-38(21,32)26(36-25)20-7-6-17(13-22(20)41-2)27(40)35-23-14-19(8-9-34-23)28(29,30)31/h6-10,12-15,18H,3-5,11,16,32H2,1-2H3/p+1/t18-,38?/m1/s1 |
| InChIKey | NLOPDJCATDKUQU-CSTFOYFXSA-O |
| XLogP | 4.23 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|