C27H24F4N7O2+ — CID 90283611
4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 90283611) has the molecular formula C27H24F4N7O2+ and a molecular weight of 554.53 g/mol. Its IUPAC name is 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90283611 |
| Molecular Formula | C27H24F4N7O2+ |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | N[N+]12C=CN=CC1=C([C@@H]1CC[C@H]3CCC(=O)N3C1)N=C2c1ccc(C(=O)Nc2cc(C(F)(F)F)ccn2)cc1F |
| InChI | InChI=1S/C27H23F4N7O2/c28-20-11-15(26(40)35-22-12-17(7-8-34-22)27(29,30)31)2-5-19(20)25-36-24(21-13-33-9-10-38(21,25)32)16-1-3-18-4-6-23(39)37(18)14-16/h2,5,7-13,16,18H,1,3-4,6,14,32H2/p+1/t16-,18+,38?/m1/s1 |
| InChIKey | QTEYMRAHENIFDY-WWQBIUEUSA-O |
| XLogP | 4.11 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|