C29H30F3N8O2+ — CID 90283551
4-[1-[(7R,9aS)-2-ethyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-7-yl]-4-aminoimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 90283551) has the molecular formula C29H30F3N8O2+ and a molecular weight of 579.61 g/mol. Its IUPAC name is 4-[1-[(7R,9aS)-2-ethyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-7-yl]-4-aminoimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[1-[(7R,9aS)-2-ethyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-7-yl]-4-aminoimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90283551 |
| Molecular Formula | C29H30F3N8O2+ |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 4-[1-[(7R,9aS)-2-ethyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-7-yl]-4-aminoimidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CCN1CC(=O)N2C[C@H](C3=C4C=NC=C[N+]4(N)C(c4ccc(C(=O)Nc5cc(C(F)(F)F)ccn5)cc4)=N3)CC[C@H]2C1 |
| InChI | InChI=1S/C29H29F3N8O2/c1-2-38-16-22-8-7-20(15-39(22)25(41)17-38)26-23-14-34-11-12-40(23,33)27(37-26)18-3-5-19(6-4-18)28(42)36-24-13-21(9-10-35-24)29(30,31)32/h3-6,9-14,20,22H,2,7-8,15-17,33H2,1H3/p+1/t20-,22+,40?/m1/s1 |
| InChIKey | BBURVXOYXDAMMS-ZNOKXWOUSA-O |
| XLogP | 3.51 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|