C26H26N7O2+ — CID 90283305
4-[4-amino-1-[(6S,8aR)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide (PubChem CID 90283305) has the molecular formula C26H26N7O2+ and a molecular weight of 468.54 g/mol. Its IUPAC name is 4-[4-amino-1-[(6S,8aR)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-amino-1-[(6S,8aR)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 90283305 |
| Molecular Formula | C26H26N7O2+ |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[4-amino-1-[(6S,8aR)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
| SMILES | N[N+]12C=CN=CC1=C([C@H]1CC[C@@H]3CCC(=O)N3C1)N=C2c1ccc(C(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C26H25N7O2/c27-33-14-13-28-15-21(33)24(19-8-9-20-10-11-23(34)32(20)16-19)31-25(33)17-4-6-18(7-5-17)26(35)30-22-3-1-2-12-29-22/h1-7,12-15,19-20H,8-11,16,27H2/p+1/t19-,20+,33?/m0/s1 |
| InChIKey | RKFLBGTUGAQRQS-YGBISPTRSA-O |
| XLogP | 2.95 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|