C26H28N7O3S+ — CID 90283635
4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 90283635) has the molecular formula C26H28N7O3S+ and a molecular weight of 518.62 g/mol. Its IUPAC name is 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 90283635 |
| Molecular Formula | C26H28N7O3S+ |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-3-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ncc(C)s2)ccc1C1=NC([C@@H]2CC[C@H]3CCC(=O)N3C2)=C2C=NC=C[N+]12N |
| InChI | InChI=1S/C26H27N7O3S/c1-15-12-29-26(37-15)31-25(35)16-4-7-19(21(11-16)36-2)24-30-23(20-13-28-9-10-33(20,24)27)17-3-5-18-6-8-22(34)32(18)14-17/h4,7,9-13,17-18H,3,5-6,8,14,27H2,1-2H3/p+1/t17-,18+,33?/m1/s1 |
| InChIKey | SKIUGIUFZSFYNT-TWKSUTPKSA-O |
| XLogP | 3.33 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|