C27H28N7O2S+ — CID 89389262
4-[4-amino-1-(1-but-2-ynoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide (PubChem CID 89389262) has the molecular formula C27H28N7O2S+ and a molecular weight of 514.64 g/mol. Its IUPAC name is 4-[4-amino-1-(1-but-2-ynoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[4-amino-1-(1-but-2-ynoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 89389262 |
| Molecular Formula | C27H28N7O2S+ |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 4-[4-amino-1-(1-but-2-ynoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(5-ethyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC#CC(=O)N1CCCCC1C1=C2C=NC=C[N+]2(N)C(c2ccc(C(=O)Nc3ncc(CC)s3)cc2)=N1 |
| InChI | InChI=1S/C27H27N7O2S/c1-3-7-23(35)33-14-6-5-8-21(33)24-22-17-29-13-15-34(22,28)25(31-24)18-9-11-19(12-10-18)26(36)32-27-30-16-20(4-2)37-27/h9-13,15-17,21H,4-6,8,14,28H2,1-2H3/p+1 |
| InChIKey | SOFHHDLFZFKSQN-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|