C26H23F3N7O3+ — CID 90283156
4-[4-amino-1-[(3R,8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 90283156) has the molecular formula C26H23F3N7O3+ and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-[4-amino-1-[(3R,8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[4-amino-1-[(3R,8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90283156 |
| Molecular Formula | C26H23F3N7O3+ |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 4-[4-amino-1-[(3R,8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-3-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | N[N+]12C=CN=CC1=C([C@H]1CN3C(=O)CC[C@@H]3CO1)N=C2c1ccc(C(=O)Nc2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C26H22F3N7O3/c27-26(28,29)17-7-8-32-21(11-17)33-25(38)16-3-1-15(2-4-16)24-34-23(19-12-31-9-10-36(19,24)30)20-13-35-18(14-39-20)5-6-22(35)37/h1-4,7-12,18,20H,5-6,13-14,30H2/p+1/t18-,20-,36?/m1/s1 |
| InChIKey | XLRDXRRGFQILPM-PZYSYUQVSA-O |
| XLogP | 2.96 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|