C26H27F3N7O3+ — CID 90311609
4-[4-amino-1-[4-(2-methoxyethyl)morpholin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 90311609) has the molecular formula C26H27F3N7O3+ and a molecular weight of 542.54 g/mol. Its IUPAC name is 4-[4-amino-1-[4-(2-methoxyethyl)morpholin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[4-amino-1-[4-(2-methoxyethyl)morpholin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90311609 |
| Molecular Formula | C26H27F3N7O3+ |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 4-[4-amino-1-[4-(2-methoxyethyl)morpholin-2-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | COCCN1CCOC(C2=C3C=NC=C[N+]3(N)C(c3ccc(C(=O)Nc4cc(C(F)(F)F)ccn4)cc3)=N2)C1 |
| InChI | InChI=1S/C26H26F3N7O3/c1-38-12-9-35-10-13-39-21(16-35)23-20-15-31-8-11-36(20,30)24(34-23)17-2-4-18(5-3-17)25(37)33-22-14-19(6-7-32-22)26(27,28)29/h2-8,11,14-15,21H,9-10,12-13,16,30H2,1H3/p+1 |
| InChIKey | ARDKDPRPMCUWQG-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|