C23H21F3N7OS+ — CID 89387574
4-(4-amino-1-thiomorpholin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 89387574) has the molecular formula C23H21F3N7OS+ and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-(4-amino-1-thiomorpholin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-(4-amino-1-thiomorpholin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 89387574 |
| Molecular Formula | C23H21F3N7OS+ |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 4-(4-amino-1-thiomorpholin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | N[N+]12C=CN=CC1=C(C1CNCCS1)N=C2c1ccc(C(=O)Nc2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C23H20F3N7OS/c24-23(25,26)16-5-6-30-19(11-16)31-22(34)15-3-1-14(2-4-15)21-32-20(18-13-29-8-10-35-18)17-12-28-7-9-33(17,21)27/h1-7,9,11-12,18,29H,8,10,13,27H2/p+1 |
| InChIKey | AXPDINFFNLIGBW-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|