C28H26F3N8O2+ — CID 89387532
4-[4-amino-1-[3-(methoxymethyl)-4,5,6,7-tetrahydro-1H-indazol-5-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 89387532) has the molecular formula C28H26F3N8O2+ and a molecular weight of 563.56 g/mol. Its IUPAC name is 4-[4-amino-1-[3-(methoxymethyl)-4,5,6,7-tetrahydro-1H-indazol-5-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[4-amino-1-[3-(methoxymethyl)-4,5,6,7-tetrahydro-1H-indazol-5-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 89387532 |
| Molecular Formula | C28H26F3N8O2+ |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 4-[4-amino-1-[3-(methoxymethyl)-4,5,6,7-tetrahydro-1H-indazol-5-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | COCc1n[nH]c2c1CC(C1=C3C=NC=C[N+]3(N)C(c3ccc(C(=O)Nc4cc(C(F)(F)F)ccn4)cc3)=N1)CC2 |
| InChI | InChI=1S/C28H25F3N8O2/c1-41-15-22-20-12-18(6-7-21(20)37-38-22)25-23-14-33-10-11-39(23,32)26(36-25)16-2-4-17(5-3-16)27(40)35-24-13-19(8-9-34-24)28(29,30)31/h2-5,8-11,13-14,18H,6-7,12,15,32H2,1H3,(H-,34,35,37,38,40)/p+1 |
| InChIKey | NHTSLUVYSCKTJR-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|