C22H21FN7O+ — CID 90186116
4-(4-amino-1-pyrrolidin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-(4-fluoro-2-pyridinyl)benzamide (PubChem CID 90186116) has the molecular formula C22H21FN7O+ and a molecular weight of 418.46 g/mol. Its IUPAC name is 4-(4-amino-1-pyrrolidin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-(4-fluoro-2-pyridinyl)benzamide.
| Compound Name | 4-(4-amino-1-pyrrolidin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-(4-fluoro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 90186116 |
| Molecular Formula | C22H21FN7O+ |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-(4-amino-1-pyrrolidin-2-ylimidazo[1,5-a]pyrazin-4-ium-3-yl)-N-(4-fluoro-2-pyridinyl)benzamide |
| SMILES | N[N+]12C=CN=CC1=C(C1CCCN1)N=C2c1ccc(C(=O)Nc2cc(F)ccn2)cc1 |
| InChI | InChI=1S/C22H20FN7O/c23-16-7-9-27-19(12-16)28-22(31)15-5-3-14(4-6-15)21-29-20(17-2-1-8-26-17)18-13-25-10-11-30(18,21)24/h3-7,9-13,17,26H,1-2,8,24H2/p+1 |
| InChIKey | KPEDZPRJUZIOBQ-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|