C25H26N7O+ — CID 89387365
4-[4-amino-1-(6-azaspiro[2.5]octan-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide (PubChem CID 89387365) has the molecular formula C25H26N7O+ and a molecular weight of 440.53 g/mol. Its IUPAC name is 4-[4-amino-1-(6-azaspiro[2.5]octan-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-amino-1-(6-azaspiro[2.5]octan-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 89387365 |
| Molecular Formula | C25H26N7O+ |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 4-[4-amino-1-(6-azaspiro[2.5]octan-2-yl)imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
| SMILES | N[N+]12C=CN=CC1=C(C1CC13CCNCC3)N=C2c1ccc(C(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C25H25N7O/c26-32-14-13-28-16-20(32)22(19-15-25(19)8-11-27-12-9-25)31-23(32)17-4-6-18(7-5-17)24(33)30-21-3-1-2-10-29-21/h1-7,10,13-14,16,19,27H,8-9,11-12,15,26H2/p+1 |
| InChIKey | RBKMYNJDQBMIHQ-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|