C24H26N7O2+ — CID 118025662
4-[4-amino-1-[[[(E)-4-methoxybut-2-enyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide (PubChem CID 118025662) has the molecular formula C24H26N7O2+ and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-[4-amino-1-[[[(E)-4-methoxybut-2-enyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[4-amino-1-[[[(E)-4-methoxybut-2-enyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 118025662 |
| Molecular Formula | C24H26N7O2+ |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 4-[4-amino-1-[[[(E)-4-methoxybut-2-enyl]amino]methyl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-pyridin-2-ylbenzamide |
| SMILES | COC/C=C/CNCC1=C2C=NC=C[N+]2(N)C(c2ccc(C(=O)Nc3ccccn3)cc2)=N1 |
| InChI | InChI=1S/C24H25N7O2/c1-33-15-5-4-11-26-16-20-21-17-27-13-14-31(21,25)23(29-20)18-7-9-19(10-8-18)24(32)30-22-6-2-3-12-28-22/h2-10,12-14,17,26H,11,15-16,25H2,1H3/p+1/b5-4+ |
| InChIKey | WTBXIYAFFSSNOJ-SNAWJCMRSA-O |
| XLogP | 2.34 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|