C7H15IN2 — CID 144511430
7-iodo-5,5-dimethyl-1,4-diazepane (PubChem CID 144511430) has the molecular formula C7H15IN2 and a molecular weight of 254.11 g/mol. Its IUPAC name is 7-iodo-5,5-dimethyl-1,4-diazepane.
| Compound Name | 7-iodo-5,5-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 144511430 |
| Molecular Formula | C7H15IN2 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 7-iodo-5,5-dimethyl-1,4-diazepane |
| SMILES | CC1(C)CC(I)NCCN1 |
| InChI | InChI=1S/C7H15IN2/c1-7(2)5-6(8)9-3-4-10-7/h6,9-10H,3-5H2,1-2H3 |
| InChIKey | SSUUFANJJHCFBP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|