C27H42O — CID 144512920
(1R,5E)-5-[(2E)-2-[(1R,3aS)-1-but-1-en-2-yl-7a-ethyl-1-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-3-ethyl-2-methylidenecyclohexan-1-ol (PubChem CID 144512920) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is (1R,5E)-5-[(2E)-2-[(1R,3aS)-1-but-1-en-2-yl-7a-ethyl-1-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-3-ethyl-2-methylidenecyclohexan-1-ol.
| Compound Name | (1R,5E)-5-[(2E)-2-[(1R,3aS)-1-but-1-en-2-yl-7a-ethyl-1-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-3-ethyl-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 144512920 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | (1R,5E)-5-[(2E)-2-[(1R,3aS)-1-but-1-en-2-yl-7a-ethyl-1-methyl-2,3,3a,5,6,7-hexahydroinden-4-ylidene]ethylidene]-3-ethyl-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1C(CC)C/C(=C\C=C2/CCCC3(CC)[C@H]2CC[C@]3(C)C(=C)CC)C[C@H]1O |
| InChI | InChI=1S/C27H42O/c1-7-19(4)26(6)16-14-24-23(11-10-15-27(24,26)9-3)13-12-21-17-22(8-2)20(5)25(28)18-21/h12-13,22,24-25,28H,4-5,7-11,14-18H2,1-3,6H3/b21-12+,23-13+/t22?,24-,25+,26+,27?/m0/s1 |
| InChIKey | LLFDOFANEBHIBN-NMNTYBQKSA-N |
| XLogP | 7.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|