C23H34O2 — CID 89166320
trans-(1R,3R)-5-[(2E)-2-[(2S,8aS)-2-ethyl-2-methyl-1,2a,3,4,4a,6,7,8-octahydrocyclobuta[i]inden-5-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 89166320) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(2S,8aS)-2-ethyl-2-methyl-1,2a,3,4,4a,6,7,8-octahydrocyclobuta[i]inden-5-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(2S,8aS)-2-ethyl-2-methyl-1,2a,3,4,4a,6,7,8-octahydrocyclobuta[i]inden-5-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 89166320 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(2S,8aS)-2-ethyl-2-methyl-1,2a,3,4,4a,6,7,8-octahydrocyclobuta[i]inden-5-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C2\CCC[C@]34C[C@](C)(CC)C3CCC24)C[C@H]1O |
| InChI | InChI=1S/C23H34O2/c1-4-22(3)14-23-11-5-6-17(18(23)9-10-21(22)23)8-7-16-12-19(24)15(2)20(25)13-16/h7-8,18-21,24-25H,2,4-6,9-14H2,1,3H3/b17-8+/t18?,19-,20-,21?,22+,23-/m1/s1 |
| InChIKey | UKVFABBBWJYJLJ-BIQDLTLOSA-N |
| XLogP | 4.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|